C11H18N2O9 — CID 87841123
2-[2-[bis(carboxymethyl)amino]ethyl-(carboxymethyl)amino]acetic acid;formaldehyde (PubChem CID 87841123) has the molecular formula C11H18N2O9 and a molecular weight of 322.27 g/mol. Its IUPAC name is 2-[2-[bis(carboxymethyl)amino]ethyl-(carboxymethyl)amino]acetic acid;formaldehyde.
| Compound Name | 2-[2-[bis(carboxymethyl)amino]ethyl-(carboxymethyl)amino]acetic acid;formaldehyde |
|---|---|
| PubChem CID | 87841123 |
| Molecular Formula | C11H18N2O9 |
| Molecular Weight | 322.27 g/mol |
| Exact Mass | 322.10 |
| IUPAC Name | 2-[2-[bis(carboxymethyl)amino]ethyl-(carboxymethyl)amino]acetic acid;formaldehyde |
| SMILES | C=O.O=C(O)CN(CCN(CC(=O)O)CC(=O)O)CC(=O)O |
| InChI | InChI=1S/C10H16N2O8.CH2O/c13-7(14)3-11(4-8(15)16)1-2-12(5-9(17)18)6-10(19)20;1-2/h1-6H2,(H,13,14)(H,15,16)(H,17,18)(H,19,20);1H2 |
| InChIKey | FDZBBXWOGXFRKI-UHFFFAOYSA-N |
| XLogP | -2.26 |
| TPSA | 172.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.27 |
| LogP ≤ 5 | -2.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |