C14H23LaN3O10+3 — CID 10230281
2-[bis[2-[bis(carboxymethyl)amino]ethyl]amino]acetic acid;lanthanum(3+) (PubChem CID 10230281) has the molecular formula C14H23LaN3O10+3 and a molecular weight of 532.26 g/mol. Its IUPAC name is 2-[bis[2-[bis(carboxymethyl)amino]ethyl]amino]acetic acid;lanthanum(3+).
| Compound Name | 2-[bis[2-[bis(carboxymethyl)amino]ethyl]amino]acetic acid;lanthanum(3+) |
|---|---|
| PubChem CID | 10230281 |
| Molecular Formula | C14H23LaN3O10+3 |
| Molecular Weight | 532.26 g/mol |
| Exact Mass | 532.04 |
| IUPAC Name | 2-[bis[2-[bis(carboxymethyl)amino]ethyl]amino]acetic acid;lanthanum(3+) |
| SMILES | O=C(O)CN(CCN(CC(=O)O)CC(=O)O)CCN(CC(=O)O)CC(=O)O.[La+3] |
| InChI | InChI=1S/C14H23N3O10.La/c18-10(19)5-15(1-3-16(6-11(20)21)7-12(22)23)2-4-17(8-13(24)25)9-14(26)27;/h1-9H2,(H,18,19)(H,20,21)(H,22,23)(H,24,25)(H,26,27);/q;+3 |
| InChIKey | OJARVAAKLAWGCY-UHFFFAOYSA-N |
| XLogP | -2.68 |
| TPSA | 196.22 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.26 |
| LogP ≤ 5 | -2.68 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |