C10H16Li2N2O8+2 — CID 10149598
dilithium;2-[2-[bis(carboxymethyl)amino]ethyl-(carboxymethyl)amino]acetic acid (PubChem CID 10149598) has the molecular formula C10H16Li2N2O8+2 and a molecular weight of 306.13 g/mol. Its IUPAC name is dilithium;2-[2-[bis(carboxymethyl)amino]ethyl-(carboxymethyl)amino]acetic acid.
| Compound Name | dilithium;2-[2-[bis(carboxymethyl)amino]ethyl-(carboxymethyl)amino]acetic acid |
|---|---|
| PubChem CID | 10149598 |
| Molecular Formula | C10H16Li2N2O8+2 |
| Molecular Weight | 306.13 g/mol |
| Exact Mass | 306.12 |
| IUPAC Name | dilithium;2-[2-[bis(carboxymethyl)amino]ethyl-(carboxymethyl)amino]acetic acid |
| SMILES | O=C(O)CN(CCN(CC(=O)O)CC(=O)O)CC(=O)O.[Li+].[Li+] |
| InChI | InChI=1S/C10H16N2O8.2Li/c13-7(14)3-11(4-8(15)16)1-2-12(5-9(17)18)6-10(19)20;;/h1-6H2,(H,13,14)(H,15,16)(H,17,18)(H,19,20);;/q;2*+1 |
| InChIKey | RDSDRBIJHLVNSE-UHFFFAOYSA-N |
| XLogP | -8.06 |
| TPSA | 155.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.13 |
| LogP ≤ 5 | -8.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |