C10H21N3O10 — CID 118382822
azane;2-[2-[bis(carboxymethyl)amino]ethyl-(carboxymethyl)amino]acetic acid;hydrogen peroxide (PubChem CID 118382822) has the molecular formula C10H21N3O10 and a molecular weight of 343.29 g/mol. Its IUPAC name is azane;2-[2-[bis(carboxymethyl)amino]ethyl-(carboxymethyl)amino]acetic acid;hydrogen peroxide.
| Compound Name | azane;2-[2-[bis(carboxymethyl)amino]ethyl-(carboxymethyl)amino]acetic acid;hydrogen peroxide |
|---|---|
| PubChem CID | 118382822 |
| Molecular Formula | C10H21N3O10 |
| Molecular Weight | 343.29 g/mol |
| Exact Mass | 343.12 |
| IUPAC Name | azane;2-[2-[bis(carboxymethyl)amino]ethyl-(carboxymethyl)amino]acetic acid;hydrogen peroxide |
| SMILES | N.O=C(O)CN(CCN(CC(=O)O)CC(=O)O)CC(=O)O.OO |
| InChI | InChI=1S/C10H16N2O8.H3N.H2O2/c13-7(14)3-11(4-8(15)16)1-2-12(5-9(17)18)6-10(19)20;;1-2/h1-6H2,(H,13,14)(H,15,16)(H,17,18)(H,19,20);1H3;1-2H |
| InChIKey | SDXFBYGLBOKBPH-UHFFFAOYSA-N |
| XLogP | -1.89 |
| TPSA | 231.14 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.29 |
| LogP ≤ 5 | -1.89 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|