C14H23FeN3O10+2 — CID 6396686
2-[bis[2-[bis(carboxymethyl)amino]ethyl]amino]acetic acid;iron(2+) (PubChem CID 6396686) has the molecular formula C14H23FeN3O10+2 and a molecular weight of 449.19 g/mol. Its IUPAC name is 2-[bis[2-[bis(carboxymethyl)amino]ethyl]amino]acetic acid;iron(2+).
| Compound Name | 2-[bis[2-[bis(carboxymethyl)amino]ethyl]amino]acetic acid;iron(2+) |
|---|---|
| PubChem CID | 6396686 |
| Molecular Formula | C14H23FeN3O10+2 |
| Molecular Weight | 449.19 g/mol |
| Exact Mass | 449.07 |
| IUPAC Name | 2-[bis[2-[bis(carboxymethyl)amino]ethyl]amino]acetic acid;iron(2+) |
| SMILES | O=C(O)CN(CCN(CC(=O)O)CC(=O)O)CCN(CC(=O)O)CC(=O)O.[Fe+2] |
| InChI | InChI=1S/C14H23N3O10.Fe/c18-10(19)5-15(1-3-16(6-11(20)21)7-12(22)23)2-4-17(8-13(24)25)9-14(26)27;/h1-9H2,(H,18,19)(H,20,21)(H,22,23)(H,24,25)(H,26,27);/q;+2 |
| InChIKey | RASZKSWRZUIIQJ-UHFFFAOYSA-N |
| XLogP | -2.69 |
| TPSA | 196.22 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.19 |
| LogP ≤ 5 | -2.69 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|