C18H32N2O8 — CID 158664985
2-[2-[bis(carboxymethyl)amino]ethyl-(carboxymethyl)amino]acetic acid;ethene (PubChem CID 158664985) has the molecular formula C18H32N2O8 and a molecular weight of 404.46 g/mol. Its IUPAC name is 2-[2-[bis(carboxymethyl)amino]ethyl-(carboxymethyl)amino]acetic acid;ethene.
| Compound Name | 2-[2-[bis(carboxymethyl)amino]ethyl-(carboxymethyl)amino]acetic acid;ethene |
|---|---|
| PubChem CID | 158664985 |
| Molecular Formula | C18H32N2O8 |
| Molecular Weight | 404.46 g/mol |
| Exact Mass | 404.22 |
| IUPAC Name | 2-[2-[bis(carboxymethyl)amino]ethyl-(carboxymethyl)amino]acetic acid;ethene |
| SMILES | C=C.C=C.C=C.C=C.O=C(O)CN(CCN(CC(=O)O)CC(=O)O)CC(=O)O |
| InChI | InChI=1S/C10H16N2O8.4C2H4/c13-7(14)3-11(4-8(15)16)1-2-12(5-9(17)18)6-10(19)20;4*1-2/h1-6H2,(H,13,14)(H,15,16)(H,17,18)(H,19,20);4*1-2H2 |
| InChIKey | IDFVGVDULWPXEA-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 155.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.46 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|