C10H18N4O6 — CID 139393080
2-[2-[(2-amino-2-oxoethyl)-(carboxymethyl)amino]ethyl-(2-nitrosoethyl)amino]acetic acid (PubChem CID 139393080) has the molecular formula C10H18N4O6 and a molecular weight of 290.28 g/mol. Its IUPAC name is 2-[2-[(2-amino-2-oxoethyl)-(carboxymethyl)amino]ethyl-(2-nitrosoethyl)amino]acetic acid.
| Compound Name | 2-[2-[(2-amino-2-oxoethyl)-(carboxymethyl)amino]ethyl-(2-nitrosoethyl)amino]acetic acid |
|---|---|
| PubChem CID | 139393080 |
| Molecular Formula | C10H18N4O6 |
| Molecular Weight | 290.28 g/mol |
| Exact Mass | 290.12 |
| IUPAC Name | 2-[2-[(2-amino-2-oxoethyl)-(carboxymethyl)amino]ethyl-(2-nitrosoethyl)amino]acetic acid |
| SMILES | NC(=O)CN(CCN(CCN=O)CC(=O)O)CC(=O)O |
| InChI | InChI=1S/C10H18N4O6/c11-8(15)5-14(7-10(18)19)4-3-13(2-1-12-20)6-9(16)17/h1-7H2,(H2,11,15)(H,16,17)(H,18,19) |
| InChIKey | PFKORCYIKVAJBV-UHFFFAOYSA-N |
| XLogP | -1.99 |
| TPSA | 153.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.28 |
| LogP ≤ 5 | -1.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |