C7H13N3O4 — CID 62921537
methyl 2-[bis(2-amino-2-oxoethyl)amino]acetate (PubChem CID 62921537) has the molecular formula C7H13N3O4 and a molecular weight of 203.20 g/mol. Its IUPAC name is methyl 2-[bis(2-amino-2-oxoethyl)amino]acetate.
| Compound Name | methyl 2-[bis(2-amino-2-oxoethyl)amino]acetate |
|---|---|
| PubChem CID | 62921537 |
| Molecular Formula | C7H13N3O4 |
| Molecular Weight | 203.20 g/mol |
| Exact Mass | 203.09 |
| IUPAC Name | methyl 2-[bis(2-amino-2-oxoethyl)amino]acetate |
| SMILES | COC(=O)CN(CC(N)=O)CC(N)=O |
| InChI | InChI=1S/C7H13N3O4/c1-14-7(13)4-10(2-5(8)11)3-6(9)12/h2-4H2,1H3,(H2,8,11)(H2,9,12) |
| InChIKey | KPHDXJZXZXKKFM-UHFFFAOYSA-N |
| XLogP | -2.57 |
| TPSA | 115.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.20 |
| LogP ≤ 5 | -2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |