C15H29N3O4 — CID 134845181
methyl 2-[bis[2-(tert-butylamino)-2-oxoethyl]amino]acetate (PubChem CID 134845181) has the molecular formula C15H29N3O4 and a molecular weight of 315.41 g/mol. Its IUPAC name is methyl 2-[bis[2-(tert-butylamino)-2-oxoethyl]amino]acetate.
| Compound Name | methyl 2-[bis[2-(tert-butylamino)-2-oxoethyl]amino]acetate |
|---|---|
| PubChem CID | 134845181 |
| Molecular Formula | C15H29N3O4 |
| Molecular Weight | 315.41 g/mol |
| Exact Mass | 315.22 |
| IUPAC Name | methyl 2-[bis[2-(tert-butylamino)-2-oxoethyl]amino]acetate |
| SMILES | COC(=O)CN(CC(=O)NC(C)(C)C)CC(=O)NC(C)(C)C |
| InChI | InChI=1S/C15H29N3O4/c1-14(2,3)16-11(19)8-18(10-13(21)22-7)9-12(20)17-15(4,5)6/h8-10H2,1-7H3,(H,16,19)(H,17,20) |
| InChIKey | NFDJACUZUGKCGD-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.41 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |