C10H23ClN2O — CID 138397018
N-tert-butyl-2-(diethylamino)acetamide;hydrochloride (PubChem CID 138397018) has the molecular formula C10H23ClN2O and a molecular weight of 222.76 g/mol. Its IUPAC name is N-tert-butyl-2-(diethylamino)acetamide;hydrochloride.
| Compound Name | N-tert-butyl-2-(diethylamino)acetamide;hydrochloride |
|---|---|
| PubChem CID | 138397018 |
| Molecular Formula | C10H23ClN2O |
| Molecular Weight | 222.76 g/mol |
| Exact Mass | 222.15 |
| IUPAC Name | N-tert-butyl-2-(diethylamino)acetamide;hydrochloride |
| SMILES | CCN(CC)CC(=O)NC(C)(C)C.Cl |
| InChI | InChI=1S/C10H22N2O.ClH/c1-6-12(7-2)8-9(13)11-10(3,4)5;/h6-8H2,1-5H3,(H,11,13);1H |
| InChIKey | GTTVZIDWGCWZRO-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.76 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |