About N-tert-butyl-N',N'-diethylpropanediamide
N-tert-butyl-N',N'-diethylpropanediamide (PubChem CID 108951053) has the molecular formula C11H22N2O2
and a molecular weight of 214.31 g/mol. Its IUPAC name is N-tert-butyl-N',N'-diethylpropanediamide.
Molecular Properties
| Compound Name | N-tert-butyl-N',N'-diethylpropanediamide |
| PubChem CID | 108951053 |
| Molecular Formula | C11H22N2O2 |
| Molecular Weight | 214.31 g/mol |
| Exact Mass | 214.17 |
| IUPAC Name | N-tert-butyl-N',N'-diethylpropanediamide |
| SMILES | CCN(CC)C(=O)CC(=O)NC(C)(C)C |
| InChI | InChI=1S/C11H22N2O2/c1-6-13(7-2)10(15)8-9(14)12-11(3,4)5/h6-8H2,1-5H3,(H,12,14) |
| InChIKey | DGPBCKWEQFRPLW-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.31 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze N-tert-butyl-N',N'-diethylpropanediamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-tert-butyl-N',N'-diethylpropanediamide?
The IUPAC name of N-tert-butyl-N',N'-diethylpropanediamide (CID 108951053) is N-tert-butyl-N',N'-diethylpropanediamide.
What is the SMILES notation for N-tert-butyl-N',N'-diethylpropanediamide?
The canonical SMILES for N-tert-butyl-N',N'-diethylpropanediamide is CCN(CC)C(=O)CC(=O)NC(C)(C)C.
What is the InChIKey of N-tert-butyl-N',N'-diethylpropanediamide?
The InChIKey is DGPBCKWEQFRPLW-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22N2O2/c1-6-13(7-2)10(15)8-9(14)12-11(3,4)5/h6-8H2,1-5H3,(H,12,14).
What are the key properties of N-tert-butyl-N',N'-diethylpropanediamide?
N-tert-butyl-N',N'-diethylpropanediamide has a molecular weight of 214.31 g/mol, XLogP of 1.16, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-tert-butyl-N',N'-diethylpropanediamide is sourced from PubChem (CID 108951053), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).