C11H22N2O3 — CID 60677092
methyl 2-[[1-(tert-butylamino)-1-oxopropan-2-yl]-methylamino]acetate (PubChem CID 60677092) has the molecular formula C11H22N2O3 and a molecular weight of 230.31 g/mol. Its IUPAC name is methyl 2-[[1-(tert-butylamino)-1-oxopropan-2-yl]-methylamino]acetate.
| Compound Name | methyl 2-[[1-(tert-butylamino)-1-oxopropan-2-yl]-methylamino]acetate |
|---|---|
| PubChem CID | 60677092 |
| Molecular Formula | C11H22N2O3 |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.16 |
| IUPAC Name | methyl 2-[[1-(tert-butylamino)-1-oxopropan-2-yl]-methylamino]acetate |
| SMILES | COC(=O)CN(C)C(C)C(=O)NC(C)(C)C |
| InChI | InChI=1S/C11H22N2O3/c1-8(10(15)12-11(2,3)4)13(5)7-9(14)16-6/h8H,7H2,1-6H3,(H,12,15) |
| InChIKey | AUDIVFCBDWVJDF-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |