C10H20N2O3 — CID 60677105
methyl 2-[methyl-[1-oxo-1-(propylamino)propan-2-yl]amino]acetate (PubChem CID 60677105) has the molecular formula C10H20N2O3 and a molecular weight of 216.28 g/mol. Its IUPAC name is methyl 2-[methyl-[1-oxo-1-(propylamino)propan-2-yl]amino]acetate.
| Compound Name | methyl 2-[methyl-[1-oxo-1-(propylamino)propan-2-yl]amino]acetate |
|---|---|
| PubChem CID | 60677105 |
| Molecular Formula | C10H20N2O3 |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.15 |
| IUPAC Name | methyl 2-[methyl-[1-oxo-1-(propylamino)propan-2-yl]amino]acetate |
| SMILES | CCCNC(=O)C(C)N(C)CC(=O)OC |
| InChI | InChI=1S/C10H20N2O3/c1-5-6-11-10(14)8(2)12(3)7-9(13)15-4/h8H,5-7H2,1-4H3,(H,11,14) |
| InChIKey | POGBHPBDLSMKJD-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |