C12H22N2O6 — CID 62953645
methyl 2-[[1-(2-methoxyethylamino)-1-oxopropan-2-yl]-(2-methoxy-2-oxoethyl)amino]acetate (PubChem CID 62953645) has the molecular formula C12H22N2O6 and a molecular weight of 290.32 g/mol. Its IUPAC name is methyl 2-[[1-(2-methoxyethylamino)-1-oxopropan-2-yl]-(2-methoxy-2-oxoethyl)amino]acetate.
| Compound Name | methyl 2-[[1-(2-methoxyethylamino)-1-oxopropan-2-yl]-(2-methoxy-2-oxoethyl)amino]acetate |
|---|---|
| PubChem CID | 62953645 |
| Molecular Formula | C12H22N2O6 |
| Molecular Weight | 290.32 g/mol |
| Exact Mass | 290.15 |
| IUPAC Name | methyl 2-[[1-(2-methoxyethylamino)-1-oxopropan-2-yl]-(2-methoxy-2-oxoethyl)amino]acetate |
| SMILES | COCCNC(=O)C(C)N(CC(=O)OC)CC(=O)OC |
| InChI | InChI=1S/C12H22N2O6/c1-9(12(17)13-5-6-18-2)14(7-10(15)19-3)8-11(16)20-4/h9H,5-8H2,1-4H3,(H,13,17) |
| InChIKey | GWOYOGKWNRIGHP-UHFFFAOYSA-N |
| XLogP | -1.21 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.32 |
| LogP ≤ 5 | -1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|