methyl 2-[2-methoxyethyl(1-methoxypropan-2-yl)amino]acetate

C10H21NO4 — CID 61067688

IUPACmethyl 2-[2-methoxyethyl(1-methoxypropan-2-yl)amino]acetate
SMILESCOCCN(CC(=O)OC)C(C)COC
InChIInChI=1S/C10H21NO4/c1-9(8-14-3)11(5-6-13-2)7-10(12)15-4/h9H,5-8H2,1-4H3
InChIKeyLKASJBYKTFMBAJ-UHFFFAOYSA-N
MW219.28 g/mol
LogP0.14
Rot. Bonds8

About methyl 2-[2-methoxyethyl(1-methoxypropan-2-yl)amino]acetate

methyl 2-[2-methoxyethyl(1-methoxypropan-2-yl)amino]acetate (PubChem CID 61067688) has the molecular formula C10H21NO4 and a molecular weight of 219.28 g/mol. Its IUPAC name is methyl 2-[2-methoxyethyl(1-methoxypropan-2-yl)amino]acetate.

Molecular Properties

Compound Namemethyl 2-[2-methoxyethyl(1-methoxypropan-2-yl)amino]acetate
PubChem CID61067688
Molecular FormulaC10H21NO4
Molecular Weight219.28 g/mol
Exact Mass219.15
IUPAC Namemethyl 2-[2-methoxyethyl(1-methoxypropan-2-yl)amino]acetate
SMILESCOCCN(CC(=O)OC)C(C)COC
InChIInChI=1S/C10H21NO4/c1-9(8-14-3)11(5-6-13-2)7-10(12)15-4/h9H,5-8H2,1-4H3
InChIKeyLKASJBYKTFMBAJ-UHFFFAOYSA-N
XLogP0.14
TPSA48.00 Ų
H-Bond Donors
H-Bond Acceptors5
Rotatable Bonds8
Heavy Atoms15
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500219.28
LogP ≤ 50.14
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 105

Analyze methyl 2-[2-methoxyethyl(1-methoxypropan-2-yl)amino]acetate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-[2-methoxyethyl(1-methoxypropan-2-yl)amino]acetate?
The IUPAC name of methyl 2-[2-methoxyethyl(1-methoxypropan-2-yl)amino]acetate (CID 61067688) is methyl 2-[2-methoxyethyl(1-methoxypropan-2-yl)amino]acetate.
What is the SMILES notation for methyl 2-[2-methoxyethyl(1-methoxypropan-2-yl)amino]acetate?
The canonical SMILES for methyl 2-[2-methoxyethyl(1-methoxypropan-2-yl)amino]acetate is COCCN(CC(=O)OC)C(C)COC.
What is the InChIKey of methyl 2-[2-methoxyethyl(1-methoxypropan-2-yl)amino]acetate?
The InChIKey is LKASJBYKTFMBAJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H21NO4/c1-9(8-14-3)11(5-6-13-2)7-10(12)15-4/h9H,5-8H2,1-4H3.
What are the key properties of methyl 2-[2-methoxyethyl(1-methoxypropan-2-yl)amino]acetate?
methyl 2-[2-methoxyethyl(1-methoxypropan-2-yl)amino]acetate has a molecular weight of 219.28 g/mol, XLogP of 0.14, 8 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[2-methoxyethyl(1-methoxypropan-2-yl)amino]acetate is sourced from PubChem (CID 61067688), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).