C12H22N2O3 — CID 112732359
2-[2-methoxyethyl(1-methoxypropan-2-yl)amino]-N-prop-2-ynylacetamide (PubChem CID 112732359) has the molecular formula C12H22N2O3 and a molecular weight of 242.32 g/mol. Its IUPAC name is 2-[2-methoxyethyl(1-methoxypropan-2-yl)amino]-N-prop-2-ynylacetamide.
| Compound Name | 2-[2-methoxyethyl(1-methoxypropan-2-yl)amino]-N-prop-2-ynylacetamide |
|---|---|
| PubChem CID | 112732359 |
| Molecular Formula | C12H22N2O3 |
| Molecular Weight | 242.32 g/mol |
| Exact Mass | 242.16 |
| IUPAC Name | 2-[2-methoxyethyl(1-methoxypropan-2-yl)amino]-N-prop-2-ynylacetamide |
| SMILES | C#CCNC(=O)CN(CCOC)C(C)COC |
| InChI | InChI=1S/C12H22N2O3/c1-5-6-13-12(15)9-14(7-8-16-3)11(2)10-17-4/h1,11H,6-10H2,2-4H3,(H,13,15) |
| InChIKey | ROMBMNQXKDMPSH-UHFFFAOYSA-N |
| XLogP | -0.28 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.32 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|