C10H20N2O4 — CID 103224639
2-[ethyl-[2-(ethylamino)-2-oxoethyl]amino]-3-methoxypropanoic acid (PubChem CID 103224639) has the molecular formula C10H20N2O4 and a molecular weight of 232.28 g/mol. Its IUPAC name is 2-[ethyl-[2-(ethylamino)-2-oxoethyl]amino]-3-methoxypropanoic acid.
| Compound Name | 2-[ethyl-[2-(ethylamino)-2-oxoethyl]amino]-3-methoxypropanoic acid |
|---|---|
| PubChem CID | 103224639 |
| Molecular Formula | C10H20N2O4 |
| Molecular Weight | 232.28 g/mol |
| Exact Mass | 232.14 |
| IUPAC Name | 2-[ethyl-[2-(ethylamino)-2-oxoethyl]amino]-3-methoxypropanoic acid |
| SMILES | CCNC(=O)CN(CC)C(COC)C(=O)O |
| InChI | InChI=1S/C10H20N2O4/c1-4-11-9(13)6-12(5-2)8(7-16-3)10(14)15/h8H,4-7H2,1-3H3,(H,11,13)(H,14,15) |
| InChIKey | LKSTYALCZRMFMC-UHFFFAOYSA-N |
| XLogP | -0.46 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.28 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |