C11H24N4O2 — CID 55213084
N-ethyl-2-[ethyl-(1-hydrazinyl-3-methyl-1-oxobutan-2-yl)amino]acetamide (PubChem CID 55213084) has the molecular formula C11H24N4O2 and a molecular weight of 244.34 g/mol. Its IUPAC name is N-ethyl-2-[ethyl-(1-hydrazinyl-3-methyl-1-oxobutan-2-yl)amino]acetamide.
| Compound Name | N-ethyl-2-[ethyl-(1-hydrazinyl-3-methyl-1-oxobutan-2-yl)amino]acetamide |
|---|---|
| PubChem CID | 55213084 |
| Molecular Formula | C11H24N4O2 |
| Molecular Weight | 244.34 g/mol |
| Exact Mass | 244.19 |
| IUPAC Name | N-ethyl-2-[ethyl-(1-hydrazinyl-3-methyl-1-oxobutan-2-yl)amino]acetamide |
| SMILES | CCNC(=O)CN(CC)C(C(=O)NN)C(C)C |
| InChI | InChI=1S/C11H24N4O2/c1-5-13-9(16)7-15(6-2)10(8(3)4)11(17)14-12/h8,10H,5-7,12H2,1-4H3,(H,13,16)(H,14,17) |
| InChIKey | LQOSKGLYJNDRDC-UHFFFAOYSA-N |
| XLogP | -0.54 |
| TPSA | 87.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.34 |
| LogP ≤ 5 | -0.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|