C16H35N3O — CID 163657277
N-ethyl-2-[ethyl-[4-(propan-2-ylamino)butyl]amino]-3-methylbutanamide (PubChem CID 163657277) has the molecular formula C16H35N3O and a molecular weight of 285.48 g/mol. Its IUPAC name is N-ethyl-2-[ethyl-[4-(propan-2-ylamino)butyl]amino]-3-methylbutanamide.
| Compound Name | N-ethyl-2-[ethyl-[4-(propan-2-ylamino)butyl]amino]-3-methylbutanamide |
|---|---|
| PubChem CID | 163657277 |
| Molecular Formula | C16H35N3O |
| Molecular Weight | 285.48 g/mol |
| Exact Mass | 285.28 |
| IUPAC Name | N-ethyl-2-[ethyl-[4-(propan-2-ylamino)butyl]amino]-3-methylbutanamide |
| SMILES | CCNC(=O)C(C(C)C)N(CC)CCCCNC(C)C |
| InChI | InChI=1S/C16H35N3O/c1-7-17-16(20)15(13(3)4)19(8-2)12-10-9-11-18-14(5)6/h13-15,18H,7-12H2,1-6H3,(H,17,20) |
| InChIKey | IRIQXYKPTIIYPV-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.48 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|