C13H29N3O — CID 154670935
2-amino-N-[8-(propan-2-ylamino)octyl]acetamide (PubChem CID 154670935) has the molecular formula C13H29N3O and a molecular weight of 243.39 g/mol. Its IUPAC name is 2-amino-N-[8-(propan-2-ylamino)octyl]acetamide.
| Compound Name | 2-amino-N-[8-(propan-2-ylamino)octyl]acetamide |
|---|---|
| PubChem CID | 154670935 |
| Molecular Formula | C13H29N3O |
| Molecular Weight | 243.39 g/mol |
| Exact Mass | 243.23 |
| IUPAC Name | 2-amino-N-[8-(propan-2-ylamino)octyl]acetamide |
| SMILES | CC(C)NCCCCCCCCNC(=O)CN |
| InChI | InChI=1S/C13H29N3O/c1-12(2)15-9-7-5-3-4-6-8-10-16-13(17)11-14/h12,15H,3-11,14H2,1-2H3,(H,16,17) |
| InChIKey | ZLASWRDTBFPRNG-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.39 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|