C17H35N3O2 — CID 130333097
N-[5-[(2-aminoacetyl)amino]pentyl]-2-tert-butyl-3,3-dimethylbutanamide (PubChem CID 130333097) has the molecular formula C17H35N3O2 and a molecular weight of 313.49 g/mol. Its IUPAC name is N-[5-[(2-aminoacetyl)amino]pentyl]-2-tert-butyl-3,3-dimethylbutanamide.
| Compound Name | N-[5-[(2-aminoacetyl)amino]pentyl]-2-tert-butyl-3,3-dimethylbutanamide |
|---|---|
| PubChem CID | 130333097 |
| Molecular Formula | C17H35N3O2 |
| Molecular Weight | 313.49 g/mol |
| Exact Mass | 313.27 |
| IUPAC Name | N-[5-[(2-aminoacetyl)amino]pentyl]-2-tert-butyl-3,3-dimethylbutanamide |
| SMILES | CC(C)(C)C(C(=O)NCCCCCNC(=O)CN)C(C)(C)C |
| InChI | InChI=1S/C17H35N3O2/c1-16(2,3)14(17(4,5)6)15(22)20-11-9-7-8-10-19-13(21)12-18/h14H,7-12,18H2,1-6H3,(H,19,21)(H,20,22) |
| InChIKey | MZHBYDWTRCCGRO-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.49 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|