C12H26N4O2 — CID 160835672
2-amino-N-[(6R)-6-[(2-aminoacetyl)amino]octyl]acetamide (PubChem CID 160835672) has the molecular formula C12H26N4O2 and a molecular weight of 258.37 g/mol. Its IUPAC name is 2-amino-N-[(6R)-6-[(2-aminoacetyl)amino]octyl]acetamide.
| Compound Name | 2-amino-N-[(6R)-6-[(2-aminoacetyl)amino]octyl]acetamide |
|---|---|
| PubChem CID | 160835672 |
| Molecular Formula | C12H26N4O2 |
| Molecular Weight | 258.37 g/mol |
| Exact Mass | 258.21 |
| IUPAC Name | 2-amino-N-[(6R)-6-[(2-aminoacetyl)amino]octyl]acetamide |
| SMILES | CC[C@H](CCCCCNC(=O)CN)NC(=O)CN |
| InChI | InChI=1S/C12H26N4O2/c1-2-10(16-12(18)9-14)6-4-3-5-7-15-11(17)8-13/h10H,2-9,13-14H2,1H3,(H,15,17)(H,16,18)/t10-/m1/s1 |
| InChIKey | SQYAXINQPUICTG-SNVBAGLBSA-N |
| XLogP | -0.52 |
| TPSA | 110.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.37 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|