C10H23N3O — CID 103929631
(2R)-2-amino-N-(4-aminobutyl)-3,3-dimethylbutanamide (PubChem CID 103929631) has the molecular formula C10H23N3O and a molecular weight of 201.31 g/mol. Its IUPAC name is (2R)-2-amino-N-(4-aminobutyl)-3,3-dimethylbutanamide.
| Compound Name | (2R)-2-amino-N-(4-aminobutyl)-3,3-dimethylbutanamide |
|---|---|
| PubChem CID | 103929631 |
| Molecular Formula | C10H23N3O |
| Molecular Weight | 201.31 g/mol |
| Exact Mass | 201.18 |
| IUPAC Name | (2R)-2-amino-N-(4-aminobutyl)-3,3-dimethylbutanamide |
| SMILES | CC(C)(C)[C@@H](N)C(=O)NCCCCN |
| InChI | InChI=1S/C10H23N3O/c1-10(2,3)8(12)9(14)13-7-5-4-6-11/h8H,4-7,11-12H2,1-3H3,(H,13,14)/t8-/m0/s1 |
| InChIKey | YIGVKPHGLZYUJN-QMMMGPOBSA-N |
| XLogP | 0.21 |
| TPSA | 81.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.31 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|