C11H25ClN2O2 — CID 119722377
(2S)-2-amino-N-(4-methoxybutyl)-3,3-dimethylbutanamide;hydrochloride (PubChem CID 119722377) has the molecular formula C11H25ClN2O2 and a molecular weight of 252.79 g/mol. Its IUPAC name is (2S)-2-amino-N-(4-methoxybutyl)-3,3-dimethylbutanamide;hydrochloride.
| Compound Name | (2S)-2-amino-N-(4-methoxybutyl)-3,3-dimethylbutanamide;hydrochloride |
|---|---|
| PubChem CID | 119722377 |
| Molecular Formula | C11H25ClN2O2 |
| Molecular Weight | 252.79 g/mol |
| Exact Mass | 252.16 |
| IUPAC Name | (2S)-2-amino-N-(4-methoxybutyl)-3,3-dimethylbutanamide;hydrochloride |
| SMILES | COCCCCNC(=O)[C@@H](N)C(C)(C)C.Cl |
| InChI | InChI=1S/C11H24N2O2.ClH/c1-11(2,3)9(12)10(14)13-7-5-6-8-15-4;/h9H,5-8,12H2,1-4H3,(H,13,14);1H/t9-;/m1./s1 |
| InChIKey | FZNDPHLHNKUXRP-SBSPUUFOSA-N |
| XLogP | 1.32 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.79 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|