C10H22N2O2 — CID 82671375
(2R)-2-amino-N-(3-methoxypropyl)-3,3-dimethylbutanamide (PubChem CID 82671375) has the molecular formula C10H22N2O2 and a molecular weight of 202.30 g/mol. Its IUPAC name is (2R)-2-amino-N-(3-methoxypropyl)-3,3-dimethylbutanamide.
| Compound Name | (2R)-2-amino-N-(3-methoxypropyl)-3,3-dimethylbutanamide |
|---|---|
| PubChem CID | 82671375 |
| Molecular Formula | C10H22N2O2 |
| Molecular Weight | 202.30 g/mol |
| Exact Mass | 202.17 |
| IUPAC Name | (2R)-2-amino-N-(3-methoxypropyl)-3,3-dimethylbutanamide |
| SMILES | COCCCNC(=O)[C@H](N)C(C)(C)C |
| InChI | InChI=1S/C10H22N2O2/c1-10(2,3)8(11)9(13)12-6-5-7-14-4/h8H,5-7,11H2,1-4H3,(H,12,13)/t8-/m0/s1 |
| InChIKey | ZVRSXJKPDDQXTB-QMMMGPOBSA-N |
| XLogP | 0.51 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.30 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|