C10H22N2O3S — CID 103929425
(2R)-2-amino-3,3-dimethyl-N-(3-methylsulfonylpropyl)butanamide (PubChem CID 103929425) has the molecular formula C10H22N2O3S and a molecular weight of 250.36 g/mol. Its IUPAC name is (2R)-2-amino-3,3-dimethyl-N-(3-methylsulfonylpropyl)butanamide.
| Compound Name | (2R)-2-amino-3,3-dimethyl-N-(3-methylsulfonylpropyl)butanamide |
|---|---|
| PubChem CID | 103929425 |
| Molecular Formula | C10H22N2O3S |
| Molecular Weight | 250.36 g/mol |
| Exact Mass | 250.14 |
| IUPAC Name | (2R)-2-amino-3,3-dimethyl-N-(3-methylsulfonylpropyl)butanamide |
| SMILES | CC(C)(C)[C@@H](N)C(=O)NCCCS(C)(=O)=O |
| InChI | InChI=1S/C10H22N2O3S/c1-10(2,3)8(11)9(13)12-6-5-7-16(4,14)15/h8H,5-7,11H2,1-4H3,(H,12,13)/t8-/m0/s1 |
| InChIKey | GOFNIBQZVUYNMS-QMMMGPOBSA-N |
| XLogP | -0.09 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.36 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|