About 2-amino-N-[3-(methanesulfonamido)propyl]-3,3-dimethylbutanamide
2-amino-N-[3-(methanesulfonamido)propyl]-3,3-dimethylbutanamide (PubChem CID 113288255) has the molecular formula C10H23N3O3S
and a molecular weight of 265.38 g/mol. Its IUPAC name is 2-amino-N-[3-(methanesulfonamido)propyl]-3,3-dimethylbutanamide.
Molecular Properties
| Compound Name | 2-amino-N-[3-(methanesulfonamido)propyl]-3,3-dimethylbutanamide |
| PubChem CID | 113288255 |
| Molecular Formula | C10H23N3O3S |
| Molecular Weight | 265.38 g/mol |
| Exact Mass | 265.15 |
| IUPAC Name | 2-amino-N-[3-(methanesulfonamido)propyl]-3,3-dimethylbutanamide |
| SMILES | CC(C)(C)C(N)C(=O)NCCCNS(C)(=O)=O |
| InChI | InChI=1S/C10H23N3O3S/c1-10(2,3)8(11)9(14)12-6-5-7-13-17(4,15)16/h8,13H,5-7,11H2,1-4H3,(H,12,14) |
| InChIKey | QEOIPCVBJOGFIM-UHFFFAOYSA-N |
| XLogP | -0.58 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.38 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-N-[3-(methanesulfonamido)propyl]-3,3-dimethylbutanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-N-[3-(methanesulfonamido)propyl]-3,3-dimethylbutanamide?
The IUPAC name of 2-amino-N-[3-(methanesulfonamido)propyl]-3,3-dimethylbutanamide (CID 113288255) is 2-amino-N-[3-(methanesulfonamido)propyl]-3,3-dimethylbutanamide.
What is the SMILES notation for 2-amino-N-[3-(methanesulfonamido)propyl]-3,3-dimethylbutanamide?
The canonical SMILES for 2-amino-N-[3-(methanesulfonamido)propyl]-3,3-dimethylbutanamide is CC(C)(C)C(N)C(=O)NCCCNS(C)(=O)=O.
What is the InChIKey of 2-amino-N-[3-(methanesulfonamido)propyl]-3,3-dimethylbutanamide?
The InChIKey is QEOIPCVBJOGFIM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H23N3O3S/c1-10(2,3)8(11)9(14)12-6-5-7-13-17(4,15)16/h8,13H,5-7,11H2,1-4H3,(H,12,14).
What are the key properties of 2-amino-N-[3-(methanesulfonamido)propyl]-3,3-dimethylbutanamide?
2-amino-N-[3-(methanesulfonamido)propyl]-3,3-dimethylbutanamide has a molecular weight of 265.38 g/mol, XLogP of -0.58, 6 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-N-[3-(methanesulfonamido)propyl]-3,3-dimethylbutanamide is sourced from PubChem (CID 113288255), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).