C10H22N4O4S — CID 106341703
2-(N'-hydroxycarbamimidoyl)-N-[3-(methanesulfonamido)propyl]-3-methylbutanamide (PubChem CID 106341703) has the molecular formula C10H22N4O4S and a molecular weight of 294.38 g/mol. Its IUPAC name is 2-(N'-hydroxycarbamimidoyl)-N-[3-(methanesulfonamido)propyl]-3-methylbutanamide.
| Compound Name | 2-(N'-hydroxycarbamimidoyl)-N-[3-(methanesulfonamido)propyl]-3-methylbutanamide |
|---|---|
| PubChem CID | 106341703 |
| Molecular Formula | C10H22N4O4S |
| Molecular Weight | 294.38 g/mol |
| Exact Mass | 294.14 |
| IUPAC Name | 2-(N'-hydroxycarbamimidoyl)-N-[3-(methanesulfonamido)propyl]-3-methylbutanamide |
| SMILES | CC(C)C(C(=O)NCCCNS(C)(=O)=O)C(N)=NO |
| InChI | InChI=1S/C10H22N4O4S/c1-7(2)8(9(11)14-16)10(15)12-5-4-6-13-19(3,17)18/h7-8,13,16H,4-6H2,1-3H3,(H2,11,14)(H,12,15) |
| InChIKey | UNVVFUTYXGQDHW-UHFFFAOYSA-N |
| XLogP | -0.94 |
| TPSA | 133.88 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.38 |
| LogP ≤ 5 | -0.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|