C9H19N5O3 — CID 83112952
N-[2-(carbamoylamino)ethyl]-2-(N'-hydroxycarbamimidoyl)-3-methylbutanamide (PubChem CID 83112952) has the molecular formula C9H19N5O3 and a molecular weight of 245.28 g/mol. Its IUPAC name is N-[2-(carbamoylamino)ethyl]-2-(N'-hydroxycarbamimidoyl)-3-methylbutanamide.
| Compound Name | N-[2-(carbamoylamino)ethyl]-2-(N'-hydroxycarbamimidoyl)-3-methylbutanamide |
|---|---|
| PubChem CID | 83112952 |
| Molecular Formula | C9H19N5O3 |
| Molecular Weight | 245.28 g/mol |
| Exact Mass | 245.15 |
| IUPAC Name | N-[2-(carbamoylamino)ethyl]-2-(N'-hydroxycarbamimidoyl)-3-methylbutanamide |
| SMILES | CC(C)C(C(=O)NCCNC(N)=O)C(N)=NO |
| InChI | InChI=1S/C9H19N5O3/c1-5(2)6(7(10)14-17)8(15)12-3-4-13-9(11)16/h5-6,17H,3-4H2,1-2H3,(H2,10,14)(H,12,15)(H3,11,13,16) |
| InChIKey | IQAOQRNSMATEHA-UHFFFAOYSA-N |
| XLogP | -1.21 |
| TPSA | 142.83 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.28 |
| LogP ≤ 5 | -1.21 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|