C10H18N6O2 — CID 55037656
2-[(Z)-N'-hydroxycarbamimidoyl]-3-methyl-N-[(4-methyl-1,2,4-triazol-3-yl)methyl]butanamide (PubChem CID 55037656) has the molecular formula C10H18N6O2 and a molecular weight of 254.29 g/mol. Its IUPAC name is 2-[(Z)-N'-hydroxycarbamimidoyl]-3-methyl-N-[(4-methyl-1,2,4-triazol-3-yl)methyl]butanamide.
| Compound Name | 2-[(Z)-N'-hydroxycarbamimidoyl]-3-methyl-N-[(4-methyl-1,2,4-triazol-3-yl)methyl]butanamide |
|---|---|
| PubChem CID | 55037656 |
| Molecular Formula | C10H18N6O2 |
| Molecular Weight | 254.29 g/mol |
| Exact Mass | 254.15 |
| IUPAC Name | 2-[(Z)-N'-hydroxycarbamimidoyl]-3-methyl-N-[(4-methyl-1,2,4-triazol-3-yl)methyl]butanamide |
| SMILES | CC(C)C(C(=O)NCc1nncn1C)/C(N)=N/O |
| InChI | InChI=1S/C10H18N6O2/c1-6(2)8(9(11)15-18)10(17)12-4-7-14-13-5-16(7)3/h5-6,8,18H,4H2,1-3H3,(H2,11,15)(H,12,17) |
| InChIKey | GAFKTYPHZHFUJL-UHFFFAOYSA-N |
| XLogP | -0.55 |
| TPSA | 118.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.29 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|