C9H15N5OS — CID 62116986
3-amino-2,2-dimethyl-N-[(4-methyl-1,2,4-triazol-3-yl)methyl]-3-sulfanylidenepropanamide (PubChem CID 62116986) has the molecular formula C9H15N5OS and a molecular weight of 241.32 g/mol. Its IUPAC name is 3-amino-2,2-dimethyl-N-[(4-methyl-1,2,4-triazol-3-yl)methyl]-3-sulfanylidenepropanamide.
| Compound Name | 3-amino-2,2-dimethyl-N-[(4-methyl-1,2,4-triazol-3-yl)methyl]-3-sulfanylidenepropanamide |
|---|---|
| PubChem CID | 62116986 |
| Molecular Formula | C9H15N5OS |
| Molecular Weight | 241.32 g/mol |
| Exact Mass | 241.10 |
| IUPAC Name | 3-amino-2,2-dimethyl-N-[(4-methyl-1,2,4-triazol-3-yl)methyl]-3-sulfanylidenepropanamide |
| SMILES | Cn1cnnc1CNC(=O)C(C)(C)C(N)=S |
| InChI | InChI=1S/C9H15N5OS/c1-9(2,7(10)16)8(15)11-4-6-13-12-5-14(6)3/h5H,4H2,1-3H3,(H2,10,16)(H,11,15) |
| InChIKey | BPWBZUBNUZMSGX-UHFFFAOYSA-N |
| XLogP | -0.26 |
| TPSA | 85.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.32 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|