C4H9N5 — CID 130979305
(4-methyl-1,2,4-triazol-3-yl)methylhydrazine (PubChem CID 130979305) has the molecular formula C4H9N5 and a molecular weight of 127.15 g/mol. Its IUPAC name is (4-methyl-1,2,4-triazol-3-yl)methylhydrazine.
| Compound Name | (4-methyl-1,2,4-triazol-3-yl)methylhydrazine |
|---|---|
| PubChem CID | 130979305 |
| Molecular Formula | C4H9N5 |
| Molecular Weight | 127.15 g/mol |
| Exact Mass | 127.09 |
| IUPAC Name | (4-methyl-1,2,4-triazol-3-yl)methylhydrazine |
| SMILES | Cn1cnnc1CNN |
| InChI | InChI=1S/C4H9N5/c1-9-3-7-8-4(9)2-6-5/h3,6H,2,5H2,1H3 |
| InChIKey | DBTRZKHJKOBUIT-UHFFFAOYSA-N |
| XLogP | -1.22 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 127.15 |
| LogP ≤ 5 | -1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|