C13H26N4 — CID 114004095
7-methyl-N-[(4-methyl-1,2,4-triazol-3-yl)methyl]octan-1-amine (PubChem CID 114004095) has the molecular formula C13H26N4 and a molecular weight of 238.38 g/mol. Its IUPAC name is 7-methyl-N-[(4-methyl-1,2,4-triazol-3-yl)methyl]octan-1-amine.
| Compound Name | 7-methyl-N-[(4-methyl-1,2,4-triazol-3-yl)methyl]octan-1-amine |
|---|---|
| PubChem CID | 114004095 |
| Molecular Formula | C13H26N4 |
| Molecular Weight | 238.38 g/mol |
| Exact Mass | 238.22 |
| IUPAC Name | 7-methyl-N-[(4-methyl-1,2,4-triazol-3-yl)methyl]octan-1-amine |
| SMILES | CC(C)CCCCCCNCc1nncn1C |
| InChI | InChI=1S/C13H26N4/c1-12(2)8-6-4-5-7-9-14-10-13-16-15-11-17(13)3/h11-12,14H,4-10H2,1-3H3 |
| InChIKey | YYFUETXHDKBZQA-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.38 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|