C10H21N5 — CID 62116960
N',N'-diethyl-N-[(4-methyl-1,2,4-triazol-3-yl)methyl]ethane-1,2-diamine (PubChem CID 62116960) has the molecular formula C10H21N5 and a molecular weight of 211.31 g/mol. Its IUPAC name is N',N'-diethyl-N-[(4-methyl-1,2,4-triazol-3-yl)methyl]ethane-1,2-diamine.
| Compound Name | N',N'-diethyl-N-[(4-methyl-1,2,4-triazol-3-yl)methyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 62116960 |
| Molecular Formula | C10H21N5 |
| Molecular Weight | 211.31 g/mol |
| Exact Mass | 211.18 |
| IUPAC Name | N',N'-diethyl-N-[(4-methyl-1,2,4-triazol-3-yl)methyl]ethane-1,2-diamine |
| SMILES | CCN(CC)CCNCc1nncn1C |
| InChI | InChI=1S/C10H21N5/c1-4-15(5-2)7-6-11-8-10-13-12-9-14(10)3/h9,11H,4-8H2,1-3H3 |
| InChIKey | CUTMYWDBIMYKDD-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 45.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.31 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|