C11H22N4 — CID 106301790
N-[(4-ethyl-1,2,4-triazol-3-yl)methyl]hexan-1-amine (PubChem CID 106301790) has the molecular formula C11H22N4 and a molecular weight of 210.32 g/mol. Its IUPAC name is N-[(4-ethyl-1,2,4-triazol-3-yl)methyl]hexan-1-amine.
| Compound Name | N-[(4-ethyl-1,2,4-triazol-3-yl)methyl]hexan-1-amine |
|---|---|
| PubChem CID | 106301790 |
| Molecular Formula | C11H22N4 |
| Molecular Weight | 210.32 g/mol |
| Exact Mass | 210.18 |
| IUPAC Name | N-[(4-ethyl-1,2,4-triazol-3-yl)methyl]hexan-1-amine |
| SMILES | CCCCCCNCc1nncn1CC |
| InChI | InChI=1S/C11H22N4/c1-3-5-6-7-8-12-9-11-14-13-10-15(11)4-2/h10,12H,3-9H2,1-2H3 |
| InChIKey | VHDWSMGWZYAQMF-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.32 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|