C13H25N5O2 — CID 107094646
tert-butyl N-[3-[(4-ethyl-1,2,4-triazol-3-yl)methylamino]propyl]carbamate (PubChem CID 107094646) has the molecular formula C13H25N5O2 and a molecular weight of 283.38 g/mol. Its IUPAC name is tert-butyl N-[3-[(4-ethyl-1,2,4-triazol-3-yl)methylamino]propyl]carbamate.
| Compound Name | tert-butyl N-[3-[(4-ethyl-1,2,4-triazol-3-yl)methylamino]propyl]carbamate |
|---|---|
| PubChem CID | 107094646 |
| Molecular Formula | C13H25N5O2 |
| Molecular Weight | 283.38 g/mol |
| Exact Mass | 283.20 |
| IUPAC Name | tert-butyl N-[3-[(4-ethyl-1,2,4-triazol-3-yl)methylamino]propyl]carbamate |
| SMILES | CCn1cnnc1CNCCCNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C13H25N5O2/c1-5-18-10-16-17-11(18)9-14-7-6-8-15-12(19)20-13(2,3)4/h10,14H,5-9H2,1-4H3,(H,15,19) |
| InChIKey | NYVOWLWACPSJDZ-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 81.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.38 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|