C15H29N5O3 — CID 103389364
tert-butyl N-[5-methoxy-4-[(4-methyl-1,2,4-triazol-3-yl)methylamino]pentyl]carbamate (PubChem CID 103389364) has the molecular formula C15H29N5O3 and a molecular weight of 327.43 g/mol. Its IUPAC name is tert-butyl N-[5-methoxy-4-[(4-methyl-1,2,4-triazol-3-yl)methylamino]pentyl]carbamate.
| Compound Name | tert-butyl N-[5-methoxy-4-[(4-methyl-1,2,4-triazol-3-yl)methylamino]pentyl]carbamate |
|---|---|
| PubChem CID | 103389364 |
| Molecular Formula | C15H29N5O3 |
| Molecular Weight | 327.43 g/mol |
| Exact Mass | 327.23 |
| IUPAC Name | tert-butyl N-[5-methoxy-4-[(4-methyl-1,2,4-triazol-3-yl)methylamino]pentyl]carbamate |
| SMILES | COCC(CCCNC(=O)OC(C)(C)C)NCc1nncn1C |
| InChI | InChI=1S/C15H29N5O3/c1-15(2,3)23-14(21)16-8-6-7-12(10-22-5)17-9-13-19-18-11-20(13)4/h11-12,17H,6-10H2,1-5H3,(H,16,21) |
| InChIKey | KWMWXABOZGLLPY-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 90.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.43 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|