C16H29N3O3S — CID 103389416
tert-butyl N-[5-methoxy-4-[(4-methyl-1,3-thiazol-2-yl)methylamino]pentyl]carbamate (PubChem CID 103389416) has the molecular formula C16H29N3O3S and a molecular weight of 343.49 g/mol. Its IUPAC name is tert-butyl N-[5-methoxy-4-[(4-methyl-1,3-thiazol-2-yl)methylamino]pentyl]carbamate.
| Compound Name | tert-butyl N-[5-methoxy-4-[(4-methyl-1,3-thiazol-2-yl)methylamino]pentyl]carbamate |
|---|---|
| PubChem CID | 103389416 |
| Molecular Formula | C16H29N3O3S |
| Molecular Weight | 343.49 g/mol |
| Exact Mass | 343.19 |
| IUPAC Name | tert-butyl N-[5-methoxy-4-[(4-methyl-1,3-thiazol-2-yl)methylamino]pentyl]carbamate |
| SMILES | COCC(CCCNC(=O)OC(C)(C)C)NCc1nc(C)cs1 |
| InChI | InChI=1S/C16H29N3O3S/c1-12-11-23-14(19-12)9-18-13(10-21-5)7-6-8-17-15(20)22-16(2,3)4/h11,13,18H,6-10H2,1-5H3,(H,17,20) |
| InChIKey | FQPAJIVOIYNWGD-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 72.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.49 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|