C15H32N2O4 — CID 103390147
tert-butyl N-[4-[(2-hydroxy-2-methylpropyl)amino]-5-methoxypentyl]carbamate (PubChem CID 103390147) has the molecular formula C15H32N2O4 and a molecular weight of 304.43 g/mol. Its IUPAC name is tert-butyl N-[4-[(2-hydroxy-2-methylpropyl)amino]-5-methoxypentyl]carbamate.
| Compound Name | tert-butyl N-[4-[(2-hydroxy-2-methylpropyl)amino]-5-methoxypentyl]carbamate |
|---|---|
| PubChem CID | 103390147 |
| Molecular Formula | C15H32N2O4 |
| Molecular Weight | 304.43 g/mol |
| Exact Mass | 304.24 |
| IUPAC Name | tert-butyl N-[4-[(2-hydroxy-2-methylpropyl)amino]-5-methoxypentyl]carbamate |
| SMILES | COCC(CCCNC(=O)OC(C)(C)C)NCC(C)(C)O |
| InChI | InChI=1S/C15H32N2O4/c1-14(2,3)21-13(18)16-9-7-8-12(10-20-6)17-11-15(4,5)19/h12,17,19H,7-11H2,1-6H3,(H,16,18) |
| InChIKey | BNNZFJFVQMGEFA-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 79.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.43 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|