C14H26F4N2O3 — CID 106289739
tert-butyl N-[5-methoxy-4-(2,2,3,3-tetrafluoropropylamino)pentyl]carbamate (PubChem CID 106289739) has the molecular formula C14H26F4N2O3 and a molecular weight of 346.37 g/mol. Its IUPAC name is tert-butyl N-[5-methoxy-4-(2,2,3,3-tetrafluoropropylamino)pentyl]carbamate.
| Compound Name | tert-butyl N-[5-methoxy-4-(2,2,3,3-tetrafluoropropylamino)pentyl]carbamate |
|---|---|
| PubChem CID | 106289739 |
| Molecular Formula | C14H26F4N2O3 |
| Molecular Weight | 346.37 g/mol |
| Exact Mass | 346.19 |
| IUPAC Name | tert-butyl N-[5-methoxy-4-(2,2,3,3-tetrafluoropropylamino)pentyl]carbamate |
| SMILES | COCC(CCCNC(=O)OC(C)(C)C)NCC(F)(F)C(F)F |
| InChI | InChI=1S/C14H26F4N2O3/c1-13(2,3)23-12(21)19-7-5-6-10(8-22-4)20-9-14(17,18)11(15)16/h10-11,20H,5-9H2,1-4H3,(H,19,21) |
| InChIKey | AFBYGNOHKLOSCI-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.37 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|