C17H36N2O4 — CID 103389448
tert-butyl N-[4-(2-butoxyethylamino)-5-methoxypentyl]carbamate (PubChem CID 103389448) has the molecular formula C17H36N2O4 and a molecular weight of 332.49 g/mol. Its IUPAC name is tert-butyl N-[4-(2-butoxyethylamino)-5-methoxypentyl]carbamate.
| Compound Name | tert-butyl N-[4-(2-butoxyethylamino)-5-methoxypentyl]carbamate |
|---|---|
| PubChem CID | 103389448 |
| Molecular Formula | C17H36N2O4 |
| Molecular Weight | 332.49 g/mol |
| Exact Mass | 332.27 |
| IUPAC Name | tert-butyl N-[4-(2-butoxyethylamino)-5-methoxypentyl]carbamate |
| SMILES | CCCCOCCNC(CCCNC(=O)OC(C)(C)C)COC |
| InChI | InChI=1S/C17H36N2O4/c1-6-7-12-22-13-11-18-15(14-21-5)9-8-10-19-16(20)23-17(2,3)4/h15,18H,6-14H2,1-5H3,(H,19,20) |
| InChIKey | HIAFSDAHSRXJEZ-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.49 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|