C13H29N3O3 — CID 107241392
tert-butyl N-[2-[(5-amino-1-methoxypentan-2-yl)amino]ethyl]carbamate (PubChem CID 107241392) has the molecular formula C13H29N3O3 and a molecular weight of 275.39 g/mol. Its IUPAC name is tert-butyl N-[2-[(5-amino-1-methoxypentan-2-yl)amino]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[(5-amino-1-methoxypentan-2-yl)amino]ethyl]carbamate |
|---|---|
| PubChem CID | 107241392 |
| Molecular Formula | C13H29N3O3 |
| Molecular Weight | 275.39 g/mol |
| Exact Mass | 275.22 |
| IUPAC Name | tert-butyl N-[2-[(5-amino-1-methoxypentan-2-yl)amino]ethyl]carbamate |
| SMILES | COCC(CCCN)NCCNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C13H29N3O3/c1-13(2,3)19-12(17)16-9-8-15-11(10-18-4)6-5-7-14/h11,15H,5-10,14H2,1-4H3,(H,16,17) |
| InChIKey | DGUHIVFOSJLQHB-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 85.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.39 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|