C15H33N3O3 — CID 107245385
tert-butyl N-[2-[(5-amino-1-methoxypentan-2-yl)amino]ethyl]-N-ethylcarbamate (PubChem CID 107245385) has the molecular formula C15H33N3O3 and a molecular weight of 303.45 g/mol. Its IUPAC name is tert-butyl N-[2-[(5-amino-1-methoxypentan-2-yl)amino]ethyl]-N-ethylcarbamate.
| Compound Name | tert-butyl N-[2-[(5-amino-1-methoxypentan-2-yl)amino]ethyl]-N-ethylcarbamate |
|---|---|
| PubChem CID | 107245385 |
| Molecular Formula | C15H33N3O3 |
| Molecular Weight | 303.45 g/mol |
| Exact Mass | 303.25 |
| IUPAC Name | tert-butyl N-[2-[(5-amino-1-methoxypentan-2-yl)amino]ethyl]-N-ethylcarbamate |
| SMILES | CCN(CCNC(CCCN)COC)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C15H33N3O3/c1-6-18(14(19)21-15(2,3)4)11-10-17-13(12-20-5)8-7-9-16/h13,17H,6-12,16H2,1-5H3 |
| InChIKey | SEBHYZGKDNIYLS-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 76.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.45 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |