C13H30N2O3 — CID 103390928
5-methoxy-4-N-[4-(2-methoxyethoxy)butyl]pentane-1,4-diamine (PubChem CID 103390928) has the molecular formula C13H30N2O3 and a molecular weight of 262.39 g/mol. Its IUPAC name is 5-methoxy-4-N-[4-(2-methoxyethoxy)butyl]pentane-1,4-diamine.
| Compound Name | 5-methoxy-4-N-[4-(2-methoxyethoxy)butyl]pentane-1,4-diamine |
|---|---|
| PubChem CID | 103390928 |
| Molecular Formula | C13H30N2O3 |
| Molecular Weight | 262.39 g/mol |
| Exact Mass | 262.23 |
| IUPAC Name | 5-methoxy-4-N-[4-(2-methoxyethoxy)butyl]pentane-1,4-diamine |
| SMILES | COCCOCCCCNC(CCCN)COC |
| InChI | InChI=1S/C13H30N2O3/c1-16-10-11-18-9-4-3-8-15-13(12-17-2)6-5-7-14/h13,15H,3-12,14H2,1-2H3 |
| InChIKey | HNIUURSAUCVYFF-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 65.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.39 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|