C11H25N3O3 — CID 103390835
2-[(5-amino-1-methoxypentan-2-yl)amino]-N-(2-methoxyethyl)acetamide (PubChem CID 103390835) has the molecular formula C11H25N3O3 and a molecular weight of 247.34 g/mol. Its IUPAC name is 2-[(5-amino-1-methoxypentan-2-yl)amino]-N-(2-methoxyethyl)acetamide.
| Compound Name | 2-[(5-amino-1-methoxypentan-2-yl)amino]-N-(2-methoxyethyl)acetamide |
|---|---|
| PubChem CID | 103390835 |
| Molecular Formula | C11H25N3O3 |
| Molecular Weight | 247.34 g/mol |
| Exact Mass | 247.19 |
| IUPAC Name | 2-[(5-amino-1-methoxypentan-2-yl)amino]-N-(2-methoxyethyl)acetamide |
| SMILES | COCCNC(=O)CNC(CCCN)COC |
| InChI | InChI=1S/C11H25N3O3/c1-16-7-6-13-11(15)8-14-10(9-17-2)4-3-5-12/h10,14H,3-9,12H2,1-2H3,(H,13,15) |
| InChIKey | URUUIFTTWVIIPP-UHFFFAOYSA-N |
| XLogP | -0.91 |
| TPSA | 85.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.34 |
| LogP ≤ 5 | -0.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|