C11H26N2O3 — CID 103389661
5-methoxy-4-N-[2-(2-methoxyethoxy)ethyl]pentane-1,4-diamine (PubChem CID 103389661) has the molecular formula C11H26N2O3 and a molecular weight of 234.34 g/mol. Its IUPAC name is 5-methoxy-4-N-[2-(2-methoxyethoxy)ethyl]pentane-1,4-diamine.
| Compound Name | 5-methoxy-4-N-[2-(2-methoxyethoxy)ethyl]pentane-1,4-diamine |
|---|---|
| PubChem CID | 103389661 |
| Molecular Formula | C11H26N2O3 |
| Molecular Weight | 234.34 g/mol |
| Exact Mass | 234.19 |
| IUPAC Name | 5-methoxy-4-N-[2-(2-methoxyethoxy)ethyl]pentane-1,4-diamine |
| SMILES | COCCOCCNC(CCCN)COC |
| InChI | InChI=1S/C11H26N2O3/c1-14-8-9-16-7-6-13-11(10-15-2)4-3-5-12/h11,13H,3-10,12H2,1-2H3 |
| InChIKey | RQIVVJSJRSURDC-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 65.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.34 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|