C13H28N2O — CID 103387807
4-N-(cyclohexylmethyl)-5-methoxypentane-1,4-diamine (PubChem CID 103387807) has the molecular formula C13H28N2O and a molecular weight of 228.38 g/mol. Its IUPAC name is 4-N-(cyclohexylmethyl)-5-methoxypentane-1,4-diamine.
| Compound Name | 4-N-(cyclohexylmethyl)-5-methoxypentane-1,4-diamine |
|---|---|
| PubChem CID | 103387807 |
| Molecular Formula | C13H28N2O |
| Molecular Weight | 228.38 g/mol |
| Exact Mass | 228.22 |
| IUPAC Name | 4-N-(cyclohexylmethyl)-5-methoxypentane-1,4-diamine |
| SMILES | COCC(CCCN)NCC1CCCCC1 |
| InChI | InChI=1S/C13H28N2O/c1-16-11-13(8-5-9-14)15-10-12-6-3-2-4-7-12/h12-13,15H,2-11,14H2,1H3 |
| InChIKey | ZOBUDPGDRXRFQD-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.38 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |