C11H24N2O2 — CID 103387634
4-N-(3-ethenoxypropyl)-5-methoxypentane-1,4-diamine (PubChem CID 103387634) has the molecular formula C11H24N2O2 and a molecular weight of 216.32 g/mol. Its IUPAC name is 4-N-(3-ethenoxypropyl)-5-methoxypentane-1,4-diamine.
| Compound Name | 4-N-(3-ethenoxypropyl)-5-methoxypentane-1,4-diamine |
|---|---|
| PubChem CID | 103387634 |
| Molecular Formula | C11H24N2O2 |
| Molecular Weight | 216.32 g/mol |
| Exact Mass | 216.18 |
| IUPAC Name | 4-N-(3-ethenoxypropyl)-5-methoxypentane-1,4-diamine |
| SMILES | C=COCCCNC(CCCN)COC |
| InChI | InChI=1S/C11H24N2O2/c1-3-15-9-5-8-13-11(10-14-2)6-4-7-12/h3,11,13H,1,4-10,12H2,2H3 |
| InChIKey | GXAGOZGTZQUSTN-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.32 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|