C10H20N2O4 — CID 126007916
2-methylpropyl N-[2-(2-methoxyethylamino)-2-oxoethyl]carbamate (PubChem CID 126007916) has the molecular formula C10H20N2O4 and a molecular weight of 232.28 g/mol. Its IUPAC name is 2-methylpropyl N-[2-(2-methoxyethylamino)-2-oxoethyl]carbamate.
| Compound Name | 2-methylpropyl N-[2-(2-methoxyethylamino)-2-oxoethyl]carbamate |
|---|---|
| PubChem CID | 126007916 |
| Molecular Formula | C10H20N2O4 |
| Molecular Weight | 232.28 g/mol |
| Exact Mass | 232.14 |
| IUPAC Name | 2-methylpropyl N-[2-(2-methoxyethylamino)-2-oxoethyl]carbamate |
| SMILES | COCCNC(=O)CNC(=O)OCC(C)C |
| InChI | InChI=1S/C10H20N2O4/c1-8(2)7-16-10(14)12-6-9(13)11-4-5-15-3/h8H,4-7H2,1-3H3,(H,11,13)(H,12,14) |
| InChIKey | HPPKRJQSMFLSPU-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.28 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|