C11H24ClN3O3 — CID 119695009
(2S)-2-amino-N-[2-(2-methoxyethylamino)-2-oxoethyl]-4-methylpentanamide;hydrochloride (PubChem CID 119695009) has the molecular formula C11H24ClN3O3 and a molecular weight of 281.78 g/mol. Its IUPAC name is (2S)-2-amino-N-[2-(2-methoxyethylamino)-2-oxoethyl]-4-methylpentanamide;hydrochloride.
| Compound Name | (2S)-2-amino-N-[2-(2-methoxyethylamino)-2-oxoethyl]-4-methylpentanamide;hydrochloride |
|---|---|
| PubChem CID | 119695009 |
| Molecular Formula | C11H24ClN3O3 |
| Molecular Weight | 281.78 g/mol |
| Exact Mass | 281.15 |
| IUPAC Name | (2S)-2-amino-N-[2-(2-methoxyethylamino)-2-oxoethyl]-4-methylpentanamide;hydrochloride |
| SMILES | COCCNC(=O)CNC(=O)[C@@H](N)CC(C)C.Cl |
| InChI | InChI=1S/C11H23N3O3.ClH/c1-8(2)6-9(12)11(16)14-7-10(15)13-4-5-17-3;/h8-9H,4-7,12H2,1-3H3,(H,13,15)(H,14,16);1H/t9-;/m0./s1 |
| InChIKey | LALKLJPVORMPJK-FVGYRXGTSA-N |
| XLogP | -0.34 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.78 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|